C19H16Cl2N2O — CID 108750525
(E)-3-(2,4-dichlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide (PubChem CID 108750525) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108750525 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H16Cl2N2O/c20-16-7-5-14(17(21)13-16)6-8-19(24)22-10-12-23-11-9-15-3-1-2-4-18(15)23/h1-9,11,13H,10,12H2,(H,22,24)/b8-6+ |
| InChIKey | OJHKLGLCKQQLTG-SOFGYWHQSA-N |
| XLogP | 4.78 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|