C17H14Cl3NO — CID 5056399
N-[2-(3-chlorophenyl)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 5056399) has the molecular formula C17H14Cl3NO and a molecular weight of 354.66 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5056399 |
| Molecular Formula | C17H14Cl3NO |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl3NO/c18-14-3-1-2-12(10-14)8-9-21-17(22)7-5-13-4-6-15(19)11-16(13)20/h1-7,10-11H,8-9H2,(H,21,22) |
| InChIKey | NDHBYFYQZMTSNK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|