C21H28N2O6S — CID 18190067
3,4,5-triethoxy-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzamide (PubChem CID 18190067) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18190067 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(C)c(S(=O)(=O)NC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H28N2O6S/c1-6-27-17-11-15(12-18(28-7-2)20(17)29-8-3)21(24)23-16-10-9-14(4)19(13-16)30(25,26)22-5/h9-13,22H,6-8H2,1-5H3,(H,23,24) |
| InChIKey | NKTZROODBZJBRF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |