C18H23NO5S — CID 9190953
2,4-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 9190953) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9190953 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2,4-dimethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2ccc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H23NO5S/c1-12-6-7-17(13(2)8-12)25(20,21)19-11-14-9-15(22-3)18(24-5)16(10-14)23-4/h6-10,19H,11H2,1-5H3 |
| InChIKey | OSBLIMMQSDAVDR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |