C15H18BNO5S — CID 144923697
[4-[[(2-methoxy-5-methylphenyl)sulfonylamino]methyl]phenyl]boronic acid (PubChem CID 144923697) has the molecular formula C15H18BNO5S and a molecular weight of 335.19 g/mol. Its IUPAC name is [4-[[(2-methoxy-5-methylphenyl)sulfonylamino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[(2-methoxy-5-methylphenyl)sulfonylamino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 144923697 |
| Molecular Formula | C15H18BNO5S |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [4-[[(2-methoxy-5-methylphenyl)sulfonylamino]methyl]phenyl]boronic acid |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H18BNO5S/c1-11-3-8-14(22-2)15(9-11)23(20,21)17-10-12-4-6-13(7-5-12)16(18)19/h3-9,17-19H,10H2,1-2H3 |
| InChIKey | IEFIEWYQFHWMRA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|