C16H16F3NO4S — CID 39624112
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-fluoro-5-methylbenzenesulfonamide (PubChem CID 39624112) has the molecular formula C16H16F3NO4S and a molecular weight of 375.37 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-fluoro-5-methylbenzenesulfonamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39624112 |
| Molecular Formula | C16H16F3NO4S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-fluoro-5-methylbenzenesulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)c2cc(C)ccc2F)ccc1OC(F)F |
| InChI | InChI=1S/C16H16F3NO4S/c1-10-3-5-12(17)15(7-10)25(21,22)20-9-11-4-6-13(24-16(18)19)14(8-11)23-2/h3-8,16,20H,9H2,1-2H3 |
| InChIKey | WWLRZIBOIPSELF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |