C14H12F3NO3S — CID 60532633
N-[2-(difluoromethoxy)phenyl]-2-fluoro-5-methylbenzenesulfonamide (PubChem CID 60532633) has the molecular formula C14H12F3NO3S and a molecular weight of 331.32 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-fluoro-5-methylbenzenesulfonamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60532633 |
| Molecular Formula | C14H12F3NO3S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)c(S(=O)(=O)Nc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C14H12F3NO3S/c1-9-6-7-10(15)13(8-9)22(19,20)18-11-4-2-3-5-12(11)21-14(16)17/h2-8,14,18H,1H3 |
| InChIKey | LATGESZEGUQFIS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |