C13H11F2NO6S — CID 99773706
4-[[2-(difluoromethoxy)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 99773706) has the molecular formula C13H11F2NO6S and a molecular weight of 347.30 g/mol. Its IUPAC name is 4-[[2-(difluoromethoxy)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[[2-(difluoromethoxy)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 99773706 |
| Molecular Formula | C13H11F2NO6S |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-[[2-(difluoromethoxy)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H11F2NO6S/c1-7-11(6-10(21-7)12(17)18)23(19,20)16-8-4-2-3-5-9(8)22-13(14)15/h2-6,13,16H,1H3,(H,17,18) |
| InChIKey | WQYBFWSQVCMKAH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |