C18H21F2NO3S — CID 7940917
5-tert-butyl-N-[2-(difluoromethoxy)phenyl]-2-methylbenzenesulfonamide (PubChem CID 7940917) has the molecular formula C18H21F2NO3S and a molecular weight of 369.43 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-(difluoromethoxy)phenyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-tert-butyl-N-[2-(difluoromethoxy)phenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7940917 |
| Molecular Formula | C18H21F2NO3S |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 5-tert-butyl-N-[2-(difluoromethoxy)phenyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H21F2NO3S/c1-12-9-10-13(18(2,3)4)11-16(12)25(22,23)21-14-7-5-6-8-15(14)24-17(19)20/h5-11,17,21H,1-4H3 |
| InChIKey | IYNVJFZNYSEFIK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |