C23H22F2N2O6S — CID 26644330
4-(difluoromethoxy)-3-methoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide (PubChem CID 26644330) has the molecular formula C23H22F2N2O6S and a molecular weight of 492.50 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide |
|---|---|
| PubChem CID | 26644330 |
| Molecular Formula | C23H22F2N2O6S |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2ccc(OC(F)F)c(OC)c2)ccc1C |
| InChI | InChI=1S/C23H22F2N2O6S/c1-14-8-10-16(13-21(14)34(29,30)27-17-6-4-5-7-18(17)31-2)26-22(28)15-9-11-19(33-23(24)25)20(12-15)32-3/h4-13,23,27H,1-3H3,(H,26,28) |
| InChIKey | FFHUMVDYZJBWAC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |