C22H20N2O6S — CID 1081903
3-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzoyl]amino]benzoic acid (PubChem CID 1081903) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is 3-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzoyl]amino]benzoic acid.
| Compound Name | 3-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1081903 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzoyl]amino]benzoic acid |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2cccc(C(=O)O)c2)ccc1C |
| InChI | InChI=1S/C22H20N2O6S/c1-14-10-11-15(21(25)23-17-7-5-6-16(12-17)22(26)27)13-20(14)31(28,29)24-18-8-3-4-9-19(18)30-2/h3-13,24H,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | BUEFROLRWJKQPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |