C25H28N2O6S — CID 26878789
N-(3,4-diethoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 26878789) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-(3,4-diethoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 26878789 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(C)c(S(=O)(=O)Nc3ccccc3OC)c2)cc1OCC |
| InChI | InChI=1S/C25H28N2O6S/c1-5-32-22-14-13-19(16-23(22)33-6-2)26-25(28)18-12-11-17(3)24(15-18)34(29,30)27-20-9-7-8-10-21(20)31-4/h7-16,27H,5-6H2,1-4H3,(H,26,28) |
| InChIKey | FGDVNSOXBRUVSD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |