C21H27N3O5S — CID 55954729
3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-[3-oxo-3-(propylamino)propyl]benzamide (PubChem CID 55954729) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-[3-oxo-3-(propylamino)propyl]benzamide.
| Compound Name | 3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-[3-oxo-3-(propylamino)propyl]benzamide |
|---|---|
| PubChem CID | 55954729 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-[3-oxo-3-(propylamino)propyl]benzamide |
| SMILES | CCCNC(=O)CCNC(=O)c1ccc(C)c(S(=O)(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-4-12-22-20(25)11-13-23-21(26)16-10-9-15(2)19(14-16)30(27,28)24-17-7-5-6-8-18(17)29-3/h5-10,14,24H,4,11-13H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | QPKSMPLTJJDXGH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |