C21H25ClN2O6S — CID 31840810
methyl 6-[[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]hexanoate (PubChem CID 31840810) has the molecular formula C21H25ClN2O6S and a molecular weight of 468.96 g/mol. Its IUPAC name is methyl 6-[[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 31840810 |
| Molecular Formula | C21H25ClN2O6S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | methyl 6-[[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C21H25ClN2O6S/c1-29-18-9-6-5-8-17(18)24-31(27,28)19-14-15(11-12-16(19)22)21(26)23-13-7-3-4-10-20(25)30-2/h5-6,8-9,11-12,14,24H,3-4,7,10,13H2,1-2H3,(H,23,26) |
| InChIKey | RSBCISWPEMLCQA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|