C24H21ClN4O4S — CID 55947709
N-(1-benzylpyrazol-4-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 55947709) has the molecular formula C24H21ClN4O4S and a molecular weight of 496.98 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55947709 |
| Molecular Formula | C24H21ClN4O4S |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2cnn(Cc3ccccc3)c2)ccc1Cl |
| InChI | InChI=1S/C24H21ClN4O4S/c1-33-22-10-6-5-9-21(22)28-34(31,32)23-13-18(11-12-20(23)25)24(30)27-19-14-26-29(16-19)15-17-7-3-2-4-8-17/h2-14,16,28H,15H2,1H3,(H,27,30) |
| InChIKey | VDZGTZNEXCOYKT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |