C21H28Cl2N3O4S- — CID 53314731
4-chloro-N-[3-(diethylamino)propyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide chloride (PubChem CID 53314731) has the molecular formula C21H28Cl2N3O4S- and a molecular weight of 489.45 g/mol. Its IUPAC name is 4-chloro-N-[3-(diethylamino)propyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide chloride.
| Compound Name | 4-chloro-N-[3-(diethylamino)propyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide chloride |
|---|---|
| PubChem CID | 53314731 |
| Molecular Formula | C21H28Cl2N3O4S- |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 4-chloro-N-[3-(diethylamino)propyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide chloride |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2ccccc2OC)c1.[Cl-] |
| InChI | InChI=1S/C21H28ClN3O4S.ClH/c1-4-25(5-2)14-8-13-23-21(26)16-11-12-17(22)20(15-16)30(27,28)24-18-9-6-7-10-19(18)29-3;/h6-7,9-12,15,24H,4-5,8,13-14H2,1-3H3,(H,23,26);1H/p-1 |
| InChIKey | GVAVAJSRWFPVSX-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|