C21H19ClN4O6S — CID 46556857
2-chloro-N-(2-methoxyphenyl)-5-[[(2-methoxypyridine-3-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 46556857) has the molecular formula C21H19ClN4O6S and a molecular weight of 490.93 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyphenyl)-5-[[(2-methoxypyridine-3-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-(2-methoxyphenyl)-5-[[(2-methoxypyridine-3-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46556857 |
| Molecular Formula | C21H19ClN4O6S |
| Molecular Weight | 490.93 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-chloro-N-(2-methoxyphenyl)-5-[[(2-methoxypyridine-3-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)NNC(=O)c2cccnc2OC)ccc1Cl |
| InChI | InChI=1S/C21H19ClN4O6S/c1-31-17-8-4-3-7-16(17)26-33(29,30)18-12-13(9-10-15(18)22)19(27)24-25-20(28)14-6-5-11-23-21(14)32-2/h3-12,26H,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | WAQQAXPUFLOXIO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.93 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|