C27H24ClN3O8S2 — CID 4097318
4-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 4097318) has the molecular formula C27H24ClN3O8S2 and a molecular weight of 618.09 g/mol. Its IUPAC name is 4-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4097318 |
| Molecular Formula | C27H24ClN3O8S2 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | 4-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccccc3OC)c2)c1 |
| InChI | InChI=1S/C27H24ClN3O8S2/c1-38-24-9-5-3-7-20(24)30-40(34,35)18-12-14-23(32)22(16-18)29-27(33)17-11-13-19(28)26(15-17)41(36,37)31-21-8-4-6-10-25(21)39-2/h3-16,30-32H,1-2H3,(H,29,33) |
| InChIKey | QEEXNXXNCZHCGZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|