C24H26N2O7S — CID 24635979
4-ethoxy-3-methoxy-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 24635979) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-ethoxy-3-methoxy-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 24635979 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-ethoxy-3-methoxy-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cc(S(=O)(=O)Nc3ccccc3OC)ccc2OC)cc1OC |
| InChI | InChI=1S/C24H26N2O7S/c1-5-33-22-12-10-16(14-23(22)32-4)24(27)25-19-15-17(11-13-21(19)31-3)34(28,29)26-18-8-6-7-9-20(18)30-2/h6-15,26H,5H2,1-4H3,(H,25,27) |
| InChIKey | FAJVONARTIIOEE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |