C22H22N2O6S — CID 43018799
2-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 43018799) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 43018799 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1cc(S(=O)(=O)Nc2ccccc2OC)ccc1O |
| InChI | InChI=1S/C22H22N2O6S/c1-3-30-20-10-6-4-8-16(20)22(26)23-18-14-15(12-13-19(18)25)31(27,28)24-17-9-5-7-11-21(17)29-2/h4-14,24-25H,3H2,1-2H3,(H,23,26) |
| InChIKey | JNKHQBQZFQRBTH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|