C25H26N2O7S — CID 24564644
4-(4-ethoxyphenyl)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide (PubChem CID 24564644) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide.
| Compound Name | 4-(4-ethoxyphenyl)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 24564644 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2cc(S(=O)(=O)Nc3ccccc3OC)ccc2O)cc1 |
| InChI | InChI=1S/C25H26N2O7S/c1-3-34-18-10-8-17(9-11-18)22(28)14-15-25(30)26-21-16-19(12-13-23(21)29)35(31,32)27-20-6-4-5-7-24(20)33-2/h4-13,16,27,29H,3,14-15H2,1-2H3,(H,26,30) |
| InChIKey | NIHGUSARRDBYKC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|