C20H24N2O6S — CID 55629222
N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(oxolan-2-yl)propanamide (PubChem CID 55629222) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(oxolan-2-yl)propanamide.
| Compound Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 55629222 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(oxolan-2-yl)propanamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)CCC2CCCO2)c1 |
| InChI | InChI=1S/C20H24N2O6S/c1-27-19-7-3-2-6-16(19)22-29(25,26)15-9-10-18(23)17(13-15)21-20(24)11-8-14-5-4-12-28-14/h2-3,6-7,9-10,13-14,22-23H,4-5,8,11-12H2,1H3,(H,21,24) |
| InChIKey | NWBCZBYWBCAVIF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|