C22H23N3O5S — CID 35994119
4-(dimethylamino)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 35994119) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 35994119 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-(dimethylamino)-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C22H23N3O5S/c1-25(2)16-10-8-15(9-11-16)22(27)23-19-14-17(12-13-20(19)26)31(28,29)24-18-6-4-5-7-21(18)30-3/h4-14,24,26H,1-3H3,(H,23,27) |
| InChIKey | QEWUBUMWVKCJHI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|