C26H24N2O6S — CID 24588283
3-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]naphthalene-2-carboxamide (PubChem CID 24588283) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is 3-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | 3-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 24588283 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 3-ethoxy-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]naphthalene-2-carboxamide |
| SMILES | CCOc1cc2ccccc2cc1C(=O)Nc1cc(S(=O)(=O)Nc2ccccc2OC)ccc1O |
| InChI | InChI=1S/C26H24N2O6S/c1-3-34-25-15-18-9-5-4-8-17(18)14-20(25)26(30)27-22-16-19(12-13-23(22)29)35(31,32)28-21-10-6-7-11-24(21)33-2/h4-16,28-29H,3H2,1-2H3,(H,27,30) |
| InChIKey | VFFFZHJQZJNHTD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|