C23H23FN2O6S — CID 31307715
4-ethoxy-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-3-methoxybenzamide (PubChem CID 31307715) has the molecular formula C23H23FN2O6S and a molecular weight of 474.51 g/mol. Its IUPAC name is 4-ethoxy-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-3-methoxybenzamide.
| Compound Name | 4-ethoxy-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 31307715 |
| Molecular Formula | C23H23FN2O6S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 4-ethoxy-N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(OC)c(NS(=O)(=O)c3ccc(F)cc3)c2)cc1OC |
| InChI | InChI=1S/C23H23FN2O6S/c1-4-32-21-11-5-15(13-22(21)31-3)23(27)25-17-8-12-20(30-2)19(14-17)26-33(28,29)18-9-6-16(24)7-10-18/h5-14,26H,4H2,1-3H3,(H,25,27) |
| InChIKey | BPJBDQLEALNBFW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |