C21H16ClN3O4S2 — CID 35993548
N-(1,3-benzothiazol-2-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 35993548) has the molecular formula C21H16ClN3O4S2 and a molecular weight of 473.96 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 35993548 |
| Molecular Formula | C21H16ClN3O4S2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-chloro-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2nc3ccccc3s2)ccc1Cl |
| InChI | InChI=1S/C21H16ClN3O4S2/c1-29-17-8-4-2-6-15(17)25-31(27,28)19-12-13(10-11-14(19)22)20(26)24-21-23-16-7-3-5-9-18(16)30-21/h2-12,25H,1H3,(H,23,24,26) |
| InChIKey | GLTGRBZVNFOBMG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |