C19H19N3O4S2 — CID 2634004
N-(1,3-benzothiazol-2-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 2634004) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2634004 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-methoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc3ccccc3s2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-26-15-9-8-13(12-17(15)28(24,25)22-10-4-5-11-22)18(23)21-19-20-14-6-2-3-7-16(14)27-19/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,20,21,23) |
| InChIKey | YPXBMPJIZFFUCK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |