C19H21N3O3S2 — CID 32678454
N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazol-2-amine (PubChem CID 32678454) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 32678454 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(Nc2nc3ccccc3s2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-25-16-10-9-14(20-19-21-15-7-3-4-8-17(15)26-19)13-18(16)27(23,24)22-11-5-2-6-12-22/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H,20,21) |
| InChIKey | TZPCLQXUDNZJPT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |