C16H19ClN2O5S3 — CID 5217515
5-chloro-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide (PubChem CID 5217515) has the molecular formula C16H19ClN2O5S3 and a molecular weight of 450.99 g/mol. Its IUPAC name is 5-chloro-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 5217515 |
| Molecular Formula | C16H19ClN2O5S3 |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 5-chloro-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H19ClN2O5S3/c1-24-13-6-5-12(18-26(20,21)16-8-7-15(17)25-16)11-14(13)27(22,23)19-9-3-2-4-10-19/h5-8,11,18H,2-4,9-10H2,1H3 |
| InChIKey | KDLXNAFJAYVJLS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |