C16H19ClN2O6S3 — CID 19684867
1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,5-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 19684867) has the molecular formula C16H19ClN2O6S3 and a molecular weight of 466.99 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,5-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,5-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 19684867 |
| Molecular Formula | C16H19ClN2O6S3 |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,5-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)c1 |
| InChI | InChI=1S/C16H19ClN2O6S3/c1-24-12-3-4-13(25-2)14(11-12)27(20,21)18-7-9-19(10-8-18)28(22,23)16-6-5-15(17)26-16/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | ZACJYYQRZRPRRU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |