C13H19NO5S — CID 103871378
1-(2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-ol (PubChem CID 103871378) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103871378 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-methylpyrrolidin-3-ol |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC(C)(O)C2)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-13(15)6-7-14(9-13)20(16,17)12-8-10(18-2)4-5-11(12)19-3/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | SBIHUXFIDRBUAX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |