C13H19NO5S — CID 4987826
4-(2,5-dimethoxyphenyl)sulfonyl-1,4-oxazepane (PubChem CID 4987826) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonyl-1,4-oxazepane.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonyl-1,4-oxazepane |
|---|---|
| PubChem CID | 4987826 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonyl-1,4-oxazepane |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCOCC2)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-17-11-4-5-12(18-2)13(10-11)20(15,16)14-6-3-8-19-9-7-14/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | BCSMAPNZEGVYGM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |