C18H23N3O6S2 — CID 2052121
4-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]sulfonylaniline (PubChem CID 2052121) has the molecular formula C18H23N3O6S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]sulfonylaniline.
| Compound Name | 4-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 2052121 |
| Molecular Formula | C18H23N3O6S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]sulfonylaniline |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(N)cc3)CC2)c1 |
| InChI | InChI=1S/C18H23N3O6S2/c1-26-15-5-8-17(27-2)18(13-15)29(24,25)21-11-9-20(10-12-21)28(22,23)16-6-3-14(19)4-7-16/h3-8,13H,9-12,19H2,1-2H3 |
| InChIKey | FWTMLWVNUDUARS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|