C13H20N4O4S — CID 2758390
4-(2,5-dimethoxyphenyl)sulfonylpiperazine-1-carboximidamide (PubChem CID 2758390) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)sulfonylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-dimethoxyphenyl)sulfonylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 2758390 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)sulfonylpiperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(S(=O)(=O)c2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C13H20N4O4S/c1-20-10-3-4-11(21-2)12(9-10)22(18,19)17-7-5-16(6-8-17)13(14)15/h3-4,9H,5-8H2,1-2H3,(H3,14,15) |
| InChIKey | LNRCEMICWJRIDP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|