C20H28N4O7S — CID 55702620
1-[2-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione (PubChem CID 55702620) has the molecular formula C20H28N4O7S and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-[2-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione.
| Compound Name | 1-[2-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 55702620 |
| Molecular Formula | C20H28N4O7S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-[2-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-4-ethylpiperazine-2,3-dione |
| SMILES | CCN1CCN(CC(=O)N2CCN(S(=O)(=O)c3cc(OC)ccc3OC)CC2)C(=O)C1=O |
| InChI | InChI=1S/C20H28N4O7S/c1-4-21-7-8-23(20(27)19(21)26)14-18(25)22-9-11-24(12-10-22)32(28,29)17-13-15(30-2)5-6-16(17)31-3/h5-6,13H,4,7-12,14H2,1-3H3 |
| InChIKey | WLUGFSNACCSMHW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 116.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|