C20H28N4O4 — CID 46493015
1-ethyl-4-[2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]piperazine-2,3-dione (PubChem CID 46493015) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-ethyl-4-[2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-[2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 46493015 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-ethyl-4-[2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-2-oxoethyl]piperazine-2,3-dione |
| SMILES | CCN1CCN(CC(=O)N2CCN(Cc3ccc(OC)cc3)CC2)C(=O)C1=O |
| InChI | InChI=1S/C20H28N4O4/c1-3-22-12-13-24(20(27)19(22)26)15-18(25)23-10-8-21(9-11-23)14-16-4-6-17(28-2)7-5-16/h4-7H,3,8-15H2,1-2H3 |
| InChIKey | MDERCQSEGSVZDW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|