C22H32N2O4S — CID 3239959
1-(1-adamantyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 3239959) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-(1-adamantyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(1-adamantyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 3239959 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 1-(1-adamantyl)-4-(2,5-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(C34CC5CC(CC(C5)C3)C4)CC2)c1 |
| InChI | InChI=1S/C22H32N2O4S/c1-27-19-3-4-20(28-2)21(12-19)29(25,26)24-7-5-23(6-8-24)22-13-16-9-17(14-22)11-18(10-16)15-22/h3-4,12,16-18H,5-11,13-15H2,1-2H3 |
| InChIKey | RRUHRQCUOJRTHJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |