C12H17NO6S — CID 79410107
(3S,4R)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 79410107) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is (3S,4R)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410107 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (3S,4R)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2C[C@@H](O)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C12H17NO6S/c1-18-8-3-4-11(19-2)12(5-8)20(16,17)13-6-9(14)10(15)7-13/h3-5,9-10,14-15H,6-7H2,1-2H3/t9-,10+ |
| InChIKey | BBXZIOMOAMEHMZ-AOOOYVTPSA-N |
| XLogP | -0.57 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |