C21H27NO5S — CID 121147234
1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methoxyphenyl)azepane (PubChem CID 121147234) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methoxyphenyl)azepane.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methoxyphenyl)azepane |
|---|---|
| PubChem CID | 121147234 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methoxyphenyl)azepane |
| SMILES | COc1ccc(C2CCCCN(S(=O)(=O)c3cc(OC)ccc3OC)C2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-25-18-9-7-16(8-10-18)17-6-4-5-13-22(15-17)28(23,24)21-14-19(26-2)11-12-20(21)27-3/h7-12,14,17H,4-6,13,15H2,1-3H3 |
| InChIKey | MVYSBQKKWLMPHW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |