C17H23N3O4S — CID 45178348
1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methyl-1H-pyrazol-5-yl)piperidine (PubChem CID 45178348) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methyl-1H-pyrazol-5-yl)piperidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methyl-1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 45178348 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4-methyl-1H-pyrazol-5-yl)piperidine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCC(c3[nH]ncc3C)C2)c1 |
| InChI | InChI=1S/C17H23N3O4S/c1-12-10-18-19-17(12)13-5-4-8-20(11-13)25(21,22)16-9-14(23-2)6-7-15(16)24-3/h6-7,9-10,13H,4-5,8,11H2,1-3H3,(H,18,19) |
| InChIKey | OWFNFCCWABRFNC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |