C19H21F2NO3S — CID 99876889
(3S)-1-(2,6-difluorophenyl)sulfonyl-3-(4-methoxyphenyl)azepane (PubChem CID 99876889) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is (3S)-1-(2,6-difluorophenyl)sulfonyl-3-(4-methoxyphenyl)azepane.
| Compound Name | (3S)-1-(2,6-difluorophenyl)sulfonyl-3-(4-methoxyphenyl)azepane |
|---|---|
| PubChem CID | 99876889 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (3S)-1-(2,6-difluorophenyl)sulfonyl-3-(4-methoxyphenyl)azepane |
| SMILES | COc1ccc([C@@H]2CCCCN(S(=O)(=O)c3c(F)cccc3F)C2)cc1 |
| InChI | InChI=1S/C19H21F2NO3S/c1-25-16-10-8-14(9-11-16)15-5-2-3-12-22(13-15)26(23,24)19-17(20)6-4-7-18(19)21/h4,6-11,15H,2-3,5,12-13H2,1H3/t15-/m1/s1 |
| InChIKey | ZVNJRYICNXRGSY-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |