C22H29NO3S — CID 121084286
3-(4-methoxyphenyl)-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpyrrolidine (PubChem CID 121084286) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(4-methoxyphenyl)-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 121084286 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(C2CCN(S(=O)(=O)c3c(C)c(C)c(C)c(C)c3C)C2)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-14-15(2)17(4)22(18(5)16(14)3)27(24,25)23-12-11-20(13-23)19-7-9-21(26-6)10-8-19/h7-10,20H,11-13H2,1-6H3 |
| InChIKey | ZMWWSRTVVSPEPN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |