C25H31N3O4S — CID 46096607
3-(4-methoxyphenyl)-5-[1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidin-4-yl]-1,2,4-oxadiazole (PubChem CID 46096607) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-[1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidin-4-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-methoxyphenyl)-5-[1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidin-4-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46096607 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-[1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidin-4-yl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(C3CCN(S(=O)(=O)c4c(C)c(C)c(C)c(C)c4C)CC3)n2)cc1 |
| InChI | InChI=1S/C25H31N3O4S/c1-15-16(2)18(4)23(19(5)17(15)3)33(29,30)28-13-11-21(12-14-28)25-26-24(27-32-25)20-7-9-22(31-6)10-8-20/h7-10,21H,11-14H2,1-6H3 |
| InChIKey | TURRZQNDVNTISZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |