C15H17N3O3 — CID 137439420
4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde (PubChem CID 137439420) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde.
| Compound Name | 4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 137439420 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde |
| SMILES | COc1ccc(-c2noc(C3CCN(C=O)CC3)n2)cc1 |
| InChI | InChI=1S/C15H17N3O3/c1-20-13-4-2-11(3-5-13)14-16-15(21-17-14)12-6-8-18(10-19)9-7-12/h2-5,10,12H,6-9H2,1H3 |
| InChIKey | UCTSLFOKXCRYCB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|