C20H25N5O4 — CID 142573619
methoxymethane;4-[3-[1-(oxetan-3-yl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde (PubChem CID 142573619) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is methoxymethane;4-[3-[1-(oxetan-3-yl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde.
| Compound Name | methoxymethane;4-[3-[1-(oxetan-3-yl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 142573619 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | methoxymethane;4-[3-[1-(oxetan-3-yl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carbaldehyde |
| SMILES | COC.O=CN1CCC(c2nc(-c3ccc4cnn(C5COC5)c4c3)no2)CC1 |
| InChI | InChI=1S/C18H19N5O3.C2H6O/c24-11-22-5-3-12(4-6-22)18-20-17(21-26-18)13-1-2-14-8-19-23(16(14)7-13)15-9-25-10-15;1-3-2/h1-2,7-8,11-12,15H,3-6,9-10H2;1-2H3 |
| InChIKey | CASBWUUHLMYUEO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|