C20H25NO3S — CID 75932086
3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine (PubChem CID 75932086) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 75932086 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(C2CCN(S(=O)(=O)c3c(C)cc(C)cc3C)C2)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-14-11-15(2)20(16(3)12-14)25(22,23)21-10-9-18(13-21)17-5-7-19(24-4)8-6-17/h5-8,11-12,18H,9-10,13H2,1-4H3 |
| InChIKey | SBZUOTKXSUFMMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |