About 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine
3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine (PubChem CID 75932086) has the molecular formula C20H25NO3S
and a molecular weight of 359.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine |
| PubChem CID | 75932086 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(C2CCN(S(=O)(=O)c3c(C)cc(C)cc3C)C2)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-14-11-15(2)20(16(3)12-14)25(22,23)21-10-9-18(13-21)17-5-7-19(24-4)8-6-17/h5-8,11-12,18H,9-10,13H2,1-4H3 |
| InChIKey | SBZUOTKXSUFMMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine?
The IUPAC name of 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine (CID 75932086) is 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine.
What is the SMILES notation for 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine?
The canonical SMILES for 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine is COc1ccc(C2CCN(S(=O)(=O)c3c(C)cc(C)cc3C)C2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine?
The InChIKey is SBZUOTKXSUFMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3S/c1-14-11-15(2)20(16(3)12-14)25(22,23)21-10-9-18(13-21)17-5-7-19(24-4)8-6-17/h5-8,11-12,18H,9-10,13H2,1-4H3.
What are the key properties of 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine?
3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine has a molecular weight of 359.49 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine is sourced from PubChem (CID 75932086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).