C21H27NO2S — CID 146627881
4-(4-methylphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine (PubChem CID 146627881) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine.
| Compound Name | 4-(4-methylphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 146627881 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-(4-methylphenyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine |
| SMILES | Cc1ccc(C2CCN(S(=O)(=O)c3c(C)cc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C21H27NO2S/c1-15-5-7-19(8-6-15)20-9-11-22(12-10-20)25(23,24)21-17(3)13-16(2)14-18(21)4/h5-8,13-14,20H,9-12H2,1-4H3 |
| InChIKey | OKNBEZYEVDHPNF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |