C17H21NO3S — CID 110603860
3-(furan-2-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine (PubChem CID 110603860) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(furan-2-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 110603860 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-(furan-2-yl)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(c3ccco3)C2)c(C)c1 |
| InChI | InChI=1S/C17H21NO3S/c1-12-9-13(2)17(14(3)10-12)22(19,20)18-7-6-15(11-18)16-5-4-8-21-16/h4-5,8-10,15H,6-7,11H2,1-3H3 |
| InChIKey | UNVKVXYBHFTROL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |