C22H29N3O5S — CID 43049249
N-[2-(furan-2-carbonylamino)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 43049249) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43049249 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C(=O)NCCNC(=O)c3ccco3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-15-13-16(2)20(17(3)14-15)31(28,29)25-10-6-18(7-11-25)21(26)23-8-9-24-22(27)19-5-4-12-30-19/h4-5,12-14,18H,6-11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | RIIHXXXCMLTWOT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|