C20H23Cl2NO3S — CID 121147273
1-(2,4-dichloro-5-methylphenyl)sulfonyl-3-(4-methoxyphenyl)azepane (PubChem CID 121147273) has the molecular formula C20H23Cl2NO3S and a molecular weight of 428.38 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-methylphenyl)sulfonyl-3-(4-methoxyphenyl)azepane.
| Compound Name | 1-(2,4-dichloro-5-methylphenyl)sulfonyl-3-(4-methoxyphenyl)azepane |
|---|---|
| PubChem CID | 121147273 |
| Molecular Formula | C20H23Cl2NO3S |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-(2,4-dichloro-5-methylphenyl)sulfonyl-3-(4-methoxyphenyl)azepane |
| SMILES | COc1ccc(C2CCCCN(S(=O)(=O)c3cc(C)c(Cl)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO3S/c1-14-11-20(19(22)12-18(14)21)27(24,25)23-10-4-3-5-16(13-23)15-6-8-17(26-2)9-7-15/h6-9,11-12,16H,3-5,10,13H2,1-2H3 |
| InChIKey | QNLZIHWSESAQBT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |